C9H16N2S — CID 11116724
1,3-diethyl-4,5-dimethylimidazole-2-thione (PubChem CID 11116724) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is 1,3-diethyl-4,5-dimethylimidazole-2-thione.
| Compound Name | 1,3-diethyl-4,5-dimethylimidazole-2-thione |
|---|---|
| PubChem CID | 11116724 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 1,3-diethyl-4,5-dimethylimidazole-2-thione |
| SMILES | CCn1c(C)c(C)n(CC)c1=S |
| InChI | InChI=1S/C9H16N2S/c1-5-10-7(3)8(4)11(6-2)9(10)12/h5-6H2,1-4H3 |
| InChIKey | JHHSUMSRHXBZSK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|