C11H20Br2N2S — CID 139124264
dibromo-[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]-λ4-sulfane (PubChem CID 139124264) has the molecular formula C11H20Br2N2S and a molecular weight of 372.17 g/mol. Its IUPAC name is dibromo-[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]-λ4-sulfane.
| Compound Name | dibromo-[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]-λ4-sulfane |
|---|---|
| PubChem CID | 139124264 |
| Molecular Formula | C11H20Br2N2S |
| Molecular Weight | 372.17 g/mol |
| Exact Mass | 369.97 |
| IUPAC Name | dibromo-[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]-λ4-sulfane |
| SMILES | Cc1c(C)n(C(C)C)c(=S(Br)Br)n1C(C)C |
| InChI | InChI=1S/C11H20Br2N2S/c1-7(2)14-9(5)10(6)15(8(3)4)11(14)16(12)13/h7-8H,1-6H3 |
| InChIKey | LFSWNZNJXCQXGF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.17 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|