C12H20N2S2-2 — CID 102318316
[4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]methanedithiolate (PubChem CID 102318316) has the molecular formula C12H20N2S2-2 and a molecular weight of 256.44 g/mol. Its IUPAC name is [4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]methanedithiolate.
| Compound Name | [4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]methanedithiolate |
|---|---|
| PubChem CID | 102318316 |
| Molecular Formula | C12H20N2S2-2 |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | [4,5-dimethyl-1,3-di(propan-2-yl)imidazol-2-ylidene]methanedithiolate |
| SMILES | CC1=C(C)N(C(C)C)C(=C([S-])[S-])N1C(C)C |
| InChI | InChI=1S/C12H22N2S2/c1-7(2)13-9(5)10(6)14(8(3)4)11(13)12(15)16/h7-8,15-16H,1-6H3/p-2 |
| InChIKey | YCOXLVURAWACMG-UHFFFAOYSA-L |
| XLogP | 2.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|