C6H9NO3 — CID 91413463
1-hydroxy-3,4-dimethylpyrrole-2,5-diol (PubChem CID 91413463) has the molecular formula C6H9NO3 and a molecular weight of 143.14 g/mol. Its IUPAC name is 1-hydroxy-3,4-dimethylpyrrole-2,5-diol.
| Compound Name | 1-hydroxy-3,4-dimethylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 91413463 |
| Molecular Formula | C6H9NO3 |
| Molecular Weight | 143.14 g/mol |
| Exact Mass | 143.06 |
| IUPAC Name | 1-hydroxy-3,4-dimethylpyrrole-2,5-diol |
| SMILES | Cc1c(C)c(O)n(O)c1O |
| InChI | InChI=1S/C6H9NO3/c1-3-4(2)6(9)7(10)5(3)8/h8-10H,1-2H3 |
| InChIKey | WXCSJXKSQWYTNP-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.14 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|