C8H13NO4 — CID 91329744
1-(2-hydroxyethoxy)-3,4-dimethylpyrrole-2,5-diol (PubChem CID 91329744) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is 1-(2-hydroxyethoxy)-3,4-dimethylpyrrole-2,5-diol.
| Compound Name | 1-(2-hydroxyethoxy)-3,4-dimethylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 91329744 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 1-(2-hydroxyethoxy)-3,4-dimethylpyrrole-2,5-diol |
| SMILES | Cc1c(C)c(O)n(OCCO)c1O |
| InChI | InChI=1S/C8H13NO4/c1-5-6(2)8(12)9(7(5)11)13-4-3-10/h10-12H,3-4H2,1-2H3 |
| InChIKey | CLZQWDWJWRPIDD-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |