C10H17NO2 — CID 91545353
1-tert-butyl-3,4-dimethylpyrrole-2,5-diol (PubChem CID 91545353) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 1-tert-butyl-3,4-dimethylpyrrole-2,5-diol.
| Compound Name | 1-tert-butyl-3,4-dimethylpyrrole-2,5-diol |
|---|---|
| PubChem CID | 91545353 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 1-tert-butyl-3,4-dimethylpyrrole-2,5-diol |
| SMILES | Cc1c(C)c(O)n(C(C)(C)C)c1O |
| InChI | InChI=1S/C10H17NO2/c1-6-7(2)9(13)11(8(6)12)10(3,4)5/h12-13H,1-5H3 |
| InChIKey | AIGYELFIVAXFOD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |