About [2,5-dihydroxy-3-methyl-4-(trihydroxy-λ4-sulfanyl)pyrrol-1-yl] carbonochloridate
[2,5-dihydroxy-3-methyl-4-(trihydroxy-λ4-sulfanyl)pyrrol-1-yl] carbonochloridate (PubChem CID 91435940) has the molecular formula C6H8ClNO7S
and a molecular weight of 273.65 g/mol. Its IUPAC name is [2,5-dihydroxy-3-methyl-4-(trihydroxy-λ4-sulfanyl)pyrrol-1-yl] carbonochloridate.
Molecular Properties
| Compound Name | [2,5-dihydroxy-3-methyl-4-(trihydroxy-λ4-sulfanyl)pyrrol-1-yl] carbonochloridate |
| PubChem CID | 91435940 |
| Molecular Formula | C6H8ClNO7S |
| Molecular Weight | 273.65 g/mol |
| Exact Mass | 272.97 |
| IUPAC Name | [2,5-dihydroxy-3-methyl-4-(trihydroxy-λ4-sulfanyl)pyrrol-1-yl] carbonochloridate |
| SMILES | Cc1c(S(O)(O)O)c(O)n(OC(=O)Cl)c1O |
| InChI | InChI=1S/C6H8ClNO7S/c1-2-3(16(12,13)14)5(10)8(4(2)9)15-6(7)11/h9-10,12-14H,1H3 |
| InChIKey | KDUBFXOGGREXQF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 132.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.65 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze [2,5-dihydroxy-3-methyl-4-(trihydroxy-λ4-sulfanyl)pyrrol-1-yl] carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,5-dihydroxy-3-methyl-4-(trihydroxy-λ4-sulfanyl)pyrrol-1-yl] carbonochloridate?
The IUPAC name of [2,5-dihydroxy-3-methyl-4-(trihydroxy-λ4-sulfanyl)pyrrol-1-yl] carbonochloridate (CID 91435940) is [2,5-dihydroxy-3-methyl-4-(trihydroxy-λ4-sulfanyl)pyrrol-1-yl] carbonochloridate.
What is the SMILES notation for [2,5-dihydroxy-3-methyl-4-(trihydroxy-λ4-sulfanyl)pyrrol-1-yl] carbonochloridate?
The canonical SMILES for [2,5-dihydroxy-3-methyl-4-(trihydroxy-λ4-sulfanyl)pyrrol-1-yl] carbonochloridate is Cc1c(S(O)(O)O)c(O)n(OC(=O)Cl)c1O.
What is the InChIKey of [2,5-dihydroxy-3-methyl-4-(trihydroxy-λ4-sulfanyl)pyrrol-1-yl] carbonochloridate?
The InChIKey is KDUBFXOGGREXQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClNO7S/c1-2-3(16(12,13)14)5(10)8(4(2)9)15-6(7)11/h9-10,12-14H,1H3.
What are the key properties of [2,5-dihydroxy-3-methyl-4-(trihydroxy-λ4-sulfanyl)pyrrol-1-yl] carbonochloridate?
[2,5-dihydroxy-3-methyl-4-(trihydroxy-λ4-sulfanyl)pyrrol-1-yl] carbonochloridate has a molecular weight of 273.65 g/mol, XLogP of 1.58, 2 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2,5-dihydroxy-3-methyl-4-(trihydroxy-λ4-sulfanyl)pyrrol-1-yl] carbonochloridate is sourced from PubChem (CID 91435940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).