C7H9NO7S3 — CID 90972514
1-[2-(disulfanyl)propanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid (PubChem CID 90972514) has the molecular formula C7H9NO7S3 and a molecular weight of 315.35 g/mol. Its IUPAC name is 1-[2-(disulfanyl)propanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid.
| Compound Name | 1-[2-(disulfanyl)propanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid |
|---|---|
| PubChem CID | 90972514 |
| Molecular Formula | C7H9NO7S3 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 314.95 |
| IUPAC Name | 1-[2-(disulfanyl)propanoyloxy]-2,5-dihydroxypyrrole-3-sulfonic acid |
| SMILES | CC(SS)C(=O)On1c(O)cc(S(=O)(=O)O)c1O |
| InChI | InChI=1S/C7H9NO7S3/c1-3(17-16)7(11)15-8-5(9)2-4(6(8)10)18(12,13)14/h2-3,9-10,16H,1H3,(H,12,13,14) |
| InChIKey | BSJOGWOUYJZPJZ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 126.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|