C29H30N4O3 — CID 123225530
(3Z,6Z)-3-[(5-tert-butyl-1H-imidazol-4-yl)methylidene]-6-[[3-[(7Z)-3-methylcycloocta-1,5,7-triene-1-carbonyl]phenyl]methylidene]piperazine-2,5-dione (PubChem CID 123225530) has the molecular formula C29H30N4O3 and a molecular weight of 482.58 g/mol. Its IUPAC name is (3Z,6Z)-3-[(5-tert-butyl-1H-imidazol-4-yl)methylidene]-6-[[3-[(7Z)-3-methylcycloocta-1,5,7-triene-1-carbonyl]phenyl]methylidene]piperazine-2,5-dione.
| Compound Name | (3Z,6Z)-3-[(5-tert-butyl-1H-imidazol-4-yl)methylidene]-6-[[3-[(7Z)-3-methylcycloocta-1,5,7-triene-1-carbonyl]phenyl]methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 123225530 |
| Molecular Formula | C29H30N4O3 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.23 |
| IUPAC Name | (3Z,6Z)-3-[(5-tert-butyl-1H-imidazol-4-yl)methylidene]-6-[[3-[(7Z)-3-methylcycloocta-1,5,7-triene-1-carbonyl]phenyl]methylidene]piperazine-2,5-dione |
| SMILES | CC1C=C(C(=O)c2cccc(/C=c3\[nH]c(=O)/c(=C/c4nc[nH]c4C(C)(C)C)[nH]c3=O)c2)/C=C\C=CC1 |
| InChI | InChI=1S/C29H30N4O3/c1-18-9-6-5-7-11-20(13-18)25(34)21-12-8-10-19(14-21)15-23-27(35)33-24(28(36)32-23)16-22-26(29(2,3)4)31-17-30-22/h5-8,10-18H,9H2,1-4H3,(H,30,31)(H,32,36)(H,33,35)/b6-5?,11-7-,20-13?,23-15-,24-16- |
| InChIKey | GYRDISNZKBNOJF-CACVDXPZSA-N |
| XLogP | 3.00 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |