C7H13NS — CID 123225939
6-ethyl-1,2,3,6-tetrahydropyridine-2-thiol (PubChem CID 123225939) has the molecular formula C7H13NS and a molecular weight of 143.25 g/mol. Its IUPAC name is 6-ethyl-1,2,3,6-tetrahydropyridine-2-thiol.
| Compound Name | 6-ethyl-1,2,3,6-tetrahydropyridine-2-thiol |
|---|---|
| PubChem CID | 123225939 |
| Molecular Formula | C7H13NS |
| Molecular Weight | 143.25 g/mol |
| Exact Mass | 143.08 |
| IUPAC Name | 6-ethyl-1,2,3,6-tetrahydropyridine-2-thiol |
| SMILES | CCC1C=CCC(S)N1 |
| InChI | InChI=1S/C7H13NS/c1-2-6-4-3-5-7(9)8-6/h3-4,6-9H,2,5H2,1H3 |
| InChIKey | IJXUHRQIOUUGBW-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|