C15H20ClNO — CID 123226002
8-chloro-4,6-dimethyl-2-(methyliminomethyl)undeca-1,6,8,10-tetraen-3-one (PubChem CID 123226002) has the molecular formula C15H20ClNO and a molecular weight of 265.78 g/mol. Its IUPAC name is 8-chloro-4,6-dimethyl-2-(methyliminomethyl)undeca-1,6,8,10-tetraen-3-one.
| Compound Name | 8-chloro-4,6-dimethyl-2-(methyliminomethyl)undeca-1,6,8,10-tetraen-3-one |
|---|---|
| PubChem CID | 123226002 |
| Molecular Formula | C15H20ClNO |
| Molecular Weight | 265.78 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 8-chloro-4,6-dimethyl-2-(methyliminomethyl)undeca-1,6,8,10-tetraen-3-one |
| SMILES | C=CC=C(Cl)C=C(C)CC(C)C(=O)C(=C)/C=N/C |
| InChI | InChI=1S/C15H20ClNO/c1-6-7-14(16)9-11(2)8-12(3)15(18)13(4)10-17-5/h6-7,9-10,12H,1,4,8H2,2-3,5H3/b11-9?,14-7?,17-10+ |
| InChIKey | GAKUVLDXUJSEPG-WPNWXFTKSA-N |
| XLogP | 4.09 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.78 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|