C15H25NO — CID 177053925
(3E)-7-methyl-3-(1-methyliminopropan-2-ylidene)dec-1-en-4-one (PubChem CID 177053925) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (3E)-7-methyl-3-(1-methyliminopropan-2-ylidene)dec-1-en-4-one.
| Compound Name | (3E)-7-methyl-3-(1-methyliminopropan-2-ylidene)dec-1-en-4-one |
|---|---|
| PubChem CID | 177053925 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (3E)-7-methyl-3-(1-methyliminopropan-2-ylidene)dec-1-en-4-one |
| SMILES | C=C/C(C(=O)CCC(C)CCC)=C(C)\C=N\C |
| InChI | InChI=1S/C15H25NO/c1-6-8-12(3)9-10-15(17)14(7-2)13(4)11-16-5/h7,11-12H,2,6,8-10H2,1,3-5H3/b14-13+,16-11+ |
| InChIKey | DPDDUJHAPJPEPN-JXZFAPNESA-N |
| XLogP | 3.97 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|