C32H63FN8O2 — CID 123226073
3,3-diamino-2-(1-butan-2-yl-3-ethyl-5-fluoro-1,3-diazinan-2-yl)-N-[2-hexyl-4-[2-methyl-4-(oxetan-3-yl)piperazin-1-yl]piperidin-3-yl]propanamide (PubChem CID 123226073) has the molecular formula C32H63FN8O2 and a molecular weight of 610.91 g/mol. Its IUPAC name is 3,3-diamino-2-(1-butan-2-yl-3-ethyl-5-fluoro-1,3-diazinan-2-yl)-N-[2-hexyl-4-[2-methyl-4-(oxetan-3-yl)piperazin-1-yl]piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(1-butan-2-yl-3-ethyl-5-fluoro-1,3-diazinan-2-yl)-N-[2-hexyl-4-[2-methyl-4-(oxetan-3-yl)piperazin-1-yl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 123226073 |
| Molecular Formula | C32H63FN8O2 |
| Molecular Weight | 610.91 g/mol |
| Exact Mass | 610.51 |
| IUPAC Name | 3,3-diamino-2-(1-butan-2-yl-3-ethyl-5-fluoro-1,3-diazinan-2-yl)-N-[2-hexyl-4-[2-methyl-4-(oxetan-3-yl)piperazin-1-yl]piperidin-3-yl]propanamide |
| SMILES | CCCCCCC1NCCC(N2CCN(C3COC3)CC2C)C1NC(=O)C(C(N)N)C1N(CC)CC(F)CN1C(C)CC |
| InChI | InChI=1S/C32H63FN8O2/c1-6-9-10-11-12-26-29(27(13-14-36-26)40-16-15-39(17-23(40)5)25-20-43-21-25)37-31(42)28(30(34)35)32-38(8-3)18-24(33)19-41(32)22(4)7-2/h22-30,32,36H,6-21,34-35H2,1-5H3,(H,37,42) |
| InChIKey | CTSKKBGKWLMPEE-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 115.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.91 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|