C24H48FN8O2+ — CID 123405907
3,3-diamino-2-(1,3-diethyl-5-fluoro-1-methyl-1,3-diazinan-1-ium-2-yl)-N-[4-[4-(oxetan-3-yl)piperazin-1-yl]piperidin-3-yl]propanamide (PubChem CID 123405907) has the molecular formula C24H48FN8O2+ and a molecular weight of 499.70 g/mol. Its IUPAC name is 3,3-diamino-2-(1,3-diethyl-5-fluoro-1-methyl-1,3-diazinan-1-ium-2-yl)-N-[4-[4-(oxetan-3-yl)piperazin-1-yl]piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(1,3-diethyl-5-fluoro-1-methyl-1,3-diazinan-1-ium-2-yl)-N-[4-[4-(oxetan-3-yl)piperazin-1-yl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 123405907 |
| Molecular Formula | C24H48FN8O2+ |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.39 |
| IUPAC Name | 3,3-diamino-2-(1,3-diethyl-5-fluoro-1-methyl-1,3-diazinan-1-ium-2-yl)-N-[4-[4-(oxetan-3-yl)piperazin-1-yl]piperidin-3-yl]propanamide |
| SMILES | CCN1CC(F)C[N+](C)(CC)C1C(C(=O)NC1CNCCC1N1CCN(C2COC2)CC1)C(N)N |
| InChI | InChI=1S/C24H47FN8O2/c1-4-30-13-17(25)14-33(3,5-2)24(30)21(22(26)27)23(34)29-19-12-28-7-6-20(19)32-10-8-31(9-11-32)18-15-35-16-18/h17-22,24,28H,4-16,26-27H2,1-3H3/p+1 |
| InChIKey | NJYQNVRNHWJAOV-UHFFFAOYSA-O |
| XLogP | -1.82 |
| TPSA | 112.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | -1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|