C25H51FN8O2+2 — CID 123602618
3,3-diamino-2-(1-ethyl-5-fluoro-3-methyl-3-propyl-4,5-dihydro-2H-pyrimidine-1,3-diium-2-yl)-N-[4-[4-(2-methoxyethyl)piperazin-1-yl]piperidin-3-yl]propanamide (PubChem CID 123602618) has the molecular formula C25H51FN8O2+2 and a molecular weight of 514.74 g/mol. Its IUPAC name is 3,3-diamino-2-(1-ethyl-5-fluoro-3-methyl-3-propyl-4,5-dihydro-2H-pyrimidine-1,3-diium-2-yl)-N-[4-[4-(2-methoxyethyl)piperazin-1-yl]piperidin-3-yl]propanamide.
| Compound Name | 3,3-diamino-2-(1-ethyl-5-fluoro-3-methyl-3-propyl-4,5-dihydro-2H-pyrimidine-1,3-diium-2-yl)-N-[4-[4-(2-methoxyethyl)piperazin-1-yl]piperidin-3-yl]propanamide |
|---|---|
| PubChem CID | 123602618 |
| Molecular Formula | C25H51FN8O2+2 |
| Molecular Weight | 514.74 g/mol |
| Exact Mass | 514.41 |
| IUPAC Name | 3,3-diamino-2-(1-ethyl-5-fluoro-3-methyl-3-propyl-4,5-dihydro-2H-pyrimidine-1,3-diium-2-yl)-N-[4-[4-(2-methoxyethyl)piperazin-1-yl]piperidin-3-yl]propanamide |
| SMILES | CCC[N+]1(C)CC(F)C=[N+](CC)C1C(C(=O)NC1CNCCC1N1CCN(CCOC)CC1)C(N)N |
| InChI | InChI=1S/C25H50FN8O2/c1-5-14-34(3)18-19(26)17-32(6-2)25(34)22(23(27)28)24(35)30-20-16-29-8-7-21(20)33-11-9-31(10-12-33)13-15-36-4/h17,19-23,25,29H,5-16,18,27-28H2,1-4H3/q+1/p+1 |
| InChIKey | VUINCRBYWXKHTP-UHFFFAOYSA-O |
| XLogP | -1.41 |
| TPSA | 111.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.74 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|