C44H34F2N8O4 — CID 123226609
4-[amino-[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]amino]-2-[[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]amino]-3-hydroxybutanamide (PubChem CID 123226609) has the molecular formula C44H34F2N8O4 and a molecular weight of 776.80 g/mol. Its IUPAC name is 4-[amino-[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]amino]-2-[[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]amino]-3-hydroxybutanamide.
| Compound Name | 4-[amino-[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]amino]-2-[[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]amino]-3-hydroxybutanamide |
|---|---|
| PubChem CID | 123226609 |
| Molecular Formula | C44H34F2N8O4 |
| Molecular Weight | 776.80 g/mol |
| Exact Mass | 776.27 |
| IUPAC Name | 4-[amino-[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]amino]-2-[[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]amino]-3-hydroxybutanamide |
| SMILES | NC(=O)C(Nc1nc(-c2ccc(Oc3ccc(F)cc3)cc2)c2ccccc2n1)C(O)CN(N)c1nc(-c2ccc(Oc3ccc(F)cc3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C44H34F2N8O4/c45-28-13-21-32(22-14-28)57-30-17-9-26(10-18-30)39-34-5-1-3-7-36(34)49-43(51-39)52-41(42(47)56)38(55)25-54(48)44-50-37-8-4-2-6-35(37)40(53-44)27-11-19-31(20-12-27)58-33-23-15-29(46)16-24-33/h1-24,38,41,55H,25,48H2,(H2,47,56)(H,49,51,52) |
| InChIKey | RVZUVHSKWYITRP-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 174.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.80 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|