C23H20FN3O3 — CID 66980131
3-[[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]amino]propane-1,2-diol (PubChem CID 66980131) has the molecular formula C23H20FN3O3 and a molecular weight of 405.43 g/mol. Its IUPAC name is 3-[[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]amino]propane-1,2-diol.
| Compound Name | 3-[[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 66980131 |
| Molecular Formula | C23H20FN3O3 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 3-[[4-[4-(4-fluorophenoxy)phenyl]quinazolin-2-yl]amino]propane-1,2-diol |
| SMILES | OCC(O)CNc1nc(-c2ccc(Oc3ccc(F)cc3)cc2)c2ccccc2n1 |
| InChI | InChI=1S/C23H20FN3O3/c24-16-7-11-19(12-8-16)30-18-9-5-15(6-10-18)22-20-3-1-2-4-21(20)26-23(27-22)25-13-17(29)14-28/h1-12,17,28-29H,13-14H2,(H,25,26,27) |
| InChIKey | GCJCWBZVMNLADH-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |