C43H41Cl2FN4O5 — CID 123226803
dichloromethane;methyl (2S)-5-[[1-(4-fluorophenyl)pyrazolo[5,4-c]pyridine-4-carbonyl]amino]-4-oxo-2-[(1R)-1-trityloxyethyl]heptanoate (PubChem CID 123226803) has the molecular formula C43H41Cl2FN4O5 and a molecular weight of 783.73 g/mol. Its IUPAC name is dichloromethane;methyl (2S)-5-[[1-(4-fluorophenyl)pyrazolo[5,4-c]pyridine-4-carbonyl]amino]-4-oxo-2-[(1R)-1-trityloxyethyl]heptanoate.
| Compound Name | dichloromethane;methyl (2S)-5-[[1-(4-fluorophenyl)pyrazolo[5,4-c]pyridine-4-carbonyl]amino]-4-oxo-2-[(1R)-1-trityloxyethyl]heptanoate |
|---|---|
| PubChem CID | 123226803 |
| Molecular Formula | C43H41Cl2FN4O5 |
| Molecular Weight | 783.73 g/mol |
| Exact Mass | 782.24 |
| IUPAC Name | dichloromethane;methyl (2S)-5-[[1-(4-fluorophenyl)pyrazolo[5,4-c]pyridine-4-carbonyl]amino]-4-oxo-2-[(1R)-1-trityloxyethyl]heptanoate |
| SMILES | CCC(NC(=O)c1cncc2c1cnn2-c1ccc(F)cc1)C(=O)C[C@H](C(=O)OC)[C@@H](C)OC(c1ccccc1)(c1ccccc1)c1ccccc1.ClCCl |
| InChI | InChI=1S/C42H39FN4O5.CH2Cl2/c1-4-37(46-40(49)36-25-44-27-38-35(36)26-45-47(38)33-22-20-32(43)21-23-33)39(48)24-34(41(50)51-3)28(2)52-42(29-14-8-5-9-15-29,30-16-10-6-11-17-30)31-18-12-7-13-19-31;2-1-3/h5-23,25-28,34,37H,4,24H2,1-3H3,(H,46,49);1H2/t28-,34+,37?;/m1./s1 |
| InChIKey | WIYINVAFCBQVCH-MGRYHXLISA-N |
| XLogP | 8.64 |
| TPSA | 112.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.73 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|