C41H37FN4O4S — CID 58084228
methyl (2R)-5-[[1-(4-fluorophenyl)pyrazolo[5,4-c]pyridine-4-carbonyl]amino]-4-oxo-2-(tritylsulfanylmethyl)heptanoate (PubChem CID 58084228) has the molecular formula C41H37FN4O4S and a molecular weight of 700.84 g/mol. Its IUPAC name is methyl (2R)-5-[[1-(4-fluorophenyl)pyrazolo[5,4-c]pyridine-4-carbonyl]amino]-4-oxo-2-(tritylsulfanylmethyl)heptanoate.
| Compound Name | methyl (2R)-5-[[1-(4-fluorophenyl)pyrazolo[5,4-c]pyridine-4-carbonyl]amino]-4-oxo-2-(tritylsulfanylmethyl)heptanoate |
|---|---|
| PubChem CID | 58084228 |
| Molecular Formula | C41H37FN4O4S |
| Molecular Weight | 700.84 g/mol |
| Exact Mass | 700.25 |
| IUPAC Name | methyl (2R)-5-[[1-(4-fluorophenyl)pyrazolo[5,4-c]pyridine-4-carbonyl]amino]-4-oxo-2-(tritylsulfanylmethyl)heptanoate |
| SMILES | CCC(NC(=O)c1cncc2c1cnn2-c1ccc(F)cc1)C(=O)C[C@@H](CSC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C41H37FN4O4S/c1-3-36(45-39(48)35-24-43-26-37-34(35)25-44-46(37)33-21-19-32(42)20-22-33)38(47)23-28(40(49)50-2)27-51-41(29-13-7-4-8-14-29,30-15-9-5-10-16-30)31-17-11-6-12-18-31/h4-22,24-26,28,36H,3,23,27H2,1-2H3,(H,45,48)/t28-,36?/m0/s1 |
| InChIKey | KMVHUAYMDHAISG-IKAFLCQNSA-N |
| XLogP | 7.54 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.84 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|