C40H36FN5O3S — CID 141264526
O-methyl (2R)-2-[2-[[1-(4-fluorophenyl)pyrazolo[5,4-c]pyridine-4-carbonyl]amino]butanoylamino]-4,4,4-triphenylbutanethioate (PubChem CID 141264526) has the molecular formula C40H36FN5O3S and a molecular weight of 685.83 g/mol. Its IUPAC name is O-methyl (2R)-2-[2-[[1-(4-fluorophenyl)pyrazolo[5,4-c]pyridine-4-carbonyl]amino]butanoylamino]-4,4,4-triphenylbutanethioate.
| Compound Name | O-methyl (2R)-2-[2-[[1-(4-fluorophenyl)pyrazolo[5,4-c]pyridine-4-carbonyl]amino]butanoylamino]-4,4,4-triphenylbutanethioate |
|---|---|
| PubChem CID | 141264526 |
| Molecular Formula | C40H36FN5O3S |
| Molecular Weight | 685.83 g/mol |
| Exact Mass | 685.25 |
| IUPAC Name | O-methyl (2R)-2-[2-[[1-(4-fluorophenyl)pyrazolo[5,4-c]pyridine-4-carbonyl]amino]butanoylamino]-4,4,4-triphenylbutanethioate |
| SMILES | CCC(NC(=O)c1cncc2c1cnn2-c1ccc(F)cc1)C(=O)N[C@H](CC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=S)OC |
| InChI | InChI=1S/C40H36FN5O3S/c1-3-34(44-37(47)33-24-42-26-36-32(33)25-43-46(36)31-21-19-30(41)20-22-31)38(48)45-35(39(50)49-2)23-40(27-13-7-4-8-14-27,28-15-9-5-10-16-28)29-17-11-6-12-18-29/h4-22,24-26,34-35H,3,23H2,1-2H3,(H,44,47)(H,45,48)/t34?,35-/m1/s1 |
| InChIKey | PDNKEENUYZDKFB-ICBMVRCQSA-N |
| XLogP | 6.95 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.83 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|