C30H52O2 — CID 123228434
(1-ethylcyclohexyl) 2-but-2-enylidene-8,8-dimethyl-6-(3-methylpentan-3-yl)dec-3-enoate (PubChem CID 123228434) has the molecular formula C30H52O2 and a molecular weight of 444.74 g/mol. Its IUPAC name is (1-ethylcyclohexyl) 2-but-2-enylidene-8,8-dimethyl-6-(3-methylpentan-3-yl)dec-3-enoate.
| Compound Name | (1-ethylcyclohexyl) 2-but-2-enylidene-8,8-dimethyl-6-(3-methylpentan-3-yl)dec-3-enoate |
|---|---|
| PubChem CID | 123228434 |
| Molecular Formula | C30H52O2 |
| Molecular Weight | 444.74 g/mol |
| Exact Mass | 444.40 |
| IUPAC Name | (1-ethylcyclohexyl) 2-but-2-enylidene-8,8-dimethyl-6-(3-methylpentan-3-yl)dec-3-enoate |
| SMILES | CC=CC=C(C=CCC(CC(C)(C)CC)C(C)(CC)CC)C(=O)OC1(CC)CCCCC1 |
| InChI | InChI=1S/C30H52O2/c1-9-14-19-25(27(31)32-30(13-5)22-16-15-17-23-30)20-18-21-26(24-28(6,7)10-2)29(8,11-3)12-4/h9,14,18-20,26H,10-13,15-17,21-24H2,1-8H3 |
| InChIKey | HEBKQLXEIDLWDE-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.74 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|