C11H20S — CID 123229612
1-ethyl-4,5-dimethyl-2-methylsulfanylcyclohexene (PubChem CID 123229612) has the molecular formula C11H20S and a molecular weight of 184.35 g/mol. Its IUPAC name is 1-ethyl-4,5-dimethyl-2-methylsulfanylcyclohexene.
| Compound Name | 1-ethyl-4,5-dimethyl-2-methylsulfanylcyclohexene |
|---|---|
| PubChem CID | 123229612 |
| Molecular Formula | C11H20S |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 1-ethyl-4,5-dimethyl-2-methylsulfanylcyclohexene |
| SMILES | CCC1=C(SC)CC(C)C(C)C1 |
| InChI | InChI=1S/C11H20S/c1-5-10-6-8(2)9(3)7-11(10)12-4/h8-9H,5-7H2,1-4H3 |
| InChIKey | OUKYPTWTIOIJNQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |