C10H18S — CID 59945016
2,3,4,5,6-pentamethyl-3,4-dihydro-2H-thiopyran (PubChem CID 59945016) has the molecular formula C10H18S and a molecular weight of 170.32 g/mol. Its IUPAC name is 2,3,4,5,6-pentamethyl-3,4-dihydro-2H-thiopyran.
| Compound Name | 2,3,4,5,6-pentamethyl-3,4-dihydro-2H-thiopyran |
|---|---|
| PubChem CID | 59945016 |
| Molecular Formula | C10H18S |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2,3,4,5,6-pentamethyl-3,4-dihydro-2H-thiopyran |
| SMILES | CC1=C(C)C(C)C(C)C(C)S1 |
| InChI | InChI=1S/C10H18S/c1-6-7(2)9(4)11-10(5)8(6)3/h6-7,9H,1-5H3 |
| InChIKey | QLOALQLLEOSBIH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |