C13H26S — CID 14689106
2,6-dimethyl-8-propan-2-ylsulfanyloct-2-ene (PubChem CID 14689106) has the molecular formula C13H26S and a molecular weight of 214.42 g/mol. Its IUPAC name is 2,6-dimethyl-8-propan-2-ylsulfanyloct-2-ene.
| Compound Name | 2,6-dimethyl-8-propan-2-ylsulfanyloct-2-ene |
|---|---|
| PubChem CID | 14689106 |
| Molecular Formula | C13H26S |
| Molecular Weight | 214.42 g/mol |
| Exact Mass | 214.18 |
| IUPAC Name | 2,6-dimethyl-8-propan-2-ylsulfanyloct-2-ene |
| SMILES | CC(C)=CCCC(C)CCSC(C)C |
| InChI | InChI=1S/C13H26S/c1-11(2)7-6-8-13(5)9-10-14-12(3)4/h7,12-13H,6,8-10H2,1-5H3 |
| InChIKey | HPQKAOBMBZPWIL-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.42 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|