C12H19FS — CID 91247320
2-(2-fluoronona-1,5-dien-4-yl)thietane (PubChem CID 91247320) has the molecular formula C12H19FS and a molecular weight of 214.35 g/mol. Its IUPAC name is 2-(2-fluoronona-1,5-dien-4-yl)thietane.
| Compound Name | 2-(2-fluoronona-1,5-dien-4-yl)thietane |
|---|---|
| PubChem CID | 91247320 |
| Molecular Formula | C12H19FS |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2-(2-fluoronona-1,5-dien-4-yl)thietane |
| SMILES | C=C(F)CC(C=CCCC)C1CCS1 |
| InChI | InChI=1S/C12H19FS/c1-3-4-5-6-11(9-10(2)13)12-7-8-14-12/h5-6,11-12H,2-4,7-9H2,1H3 |
| InChIKey | WNOOGCDZLOAFEN-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|