C12H22S2 — CID 134988798
2,3,4-trimethyl-6-methylsulfanyl-6-propan-2-yl-2,5-dihydrothiopyran (PubChem CID 134988798) has the molecular formula C12H22S2 and a molecular weight of 230.44 g/mol. Its IUPAC name is 2,3,4-trimethyl-6-methylsulfanyl-6-propan-2-yl-2,5-dihydrothiopyran.
| Compound Name | 2,3,4-trimethyl-6-methylsulfanyl-6-propan-2-yl-2,5-dihydrothiopyran |
|---|---|
| PubChem CID | 134988798 |
| Molecular Formula | C12H22S2 |
| Molecular Weight | 230.44 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 2,3,4-trimethyl-6-methylsulfanyl-6-propan-2-yl-2,5-dihydrothiopyran |
| SMILES | CSC1(C(C)C)CC(C)=C(C)C(C)S1 |
| InChI | InChI=1S/C12H22S2/c1-8(2)12(13-6)7-9(3)10(4)11(5)14-12/h8,11H,7H2,1-6H3 |
| InChIKey | WOPGJVJFWHLDQD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.44 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|