C9H16S2 — CID 12669525
6-methylsulfanyl-6-propan-2-yl-2,5-dihydrothiopyran (PubChem CID 12669525) has the molecular formula C9H16S2 and a molecular weight of 188.36 g/mol. Its IUPAC name is 6-methylsulfanyl-6-propan-2-yl-2,5-dihydrothiopyran.
| Compound Name | 6-methylsulfanyl-6-propan-2-yl-2,5-dihydrothiopyran |
|---|---|
| PubChem CID | 12669525 |
| Molecular Formula | C9H16S2 |
| Molecular Weight | 188.36 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | 6-methylsulfanyl-6-propan-2-yl-2,5-dihydrothiopyran |
| SMILES | CSC1(C(C)C)CC=CCS1 |
| InChI | InChI=1S/C9H16S2/c1-8(2)9(10-3)6-4-5-7-11-9/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | OUWDYYLKQRXOBM-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.36 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|