C10H16S2 — CID 13087920
2-cyclohex-3-en-1-yl-1,3-dithiane (PubChem CID 13087920) has the molecular formula C10H16S2 and a molecular weight of 200.37 g/mol. Its IUPAC name is 2-cyclohex-3-en-1-yl-1,3-dithiane.
| Compound Name | 2-cyclohex-3-en-1-yl-1,3-dithiane |
|---|---|
| PubChem CID | 13087920 |
| Molecular Formula | C10H16S2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 2-cyclohex-3-en-1-yl-1,3-dithiane |
| SMILES | C1=CCC(C2SCCCS2)CC1 |
| InChI | InChI=1S/C10H16S2/c1-2-5-9(6-3-1)10-11-7-4-8-12-10/h1-2,9-10H,3-8H2 |
| InChIKey | ZUKKZTVUSDLLSI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|