C11H14S2 — CID 135033930
(1S,9S)-3,6-dithiatricyclo[7.2.2.02,7]trideca-2(7),10-diene (PubChem CID 135033930) has the molecular formula C11H14S2 and a molecular weight of 210.37 g/mol. Its IUPAC name is (1S,9S)-3,6-dithiatricyclo[7.2.2.02,7]trideca-2(7),10-diene.
| Compound Name | (1S,9S)-3,6-dithiatricyclo[7.2.2.02,7]trideca-2(7),10-diene |
|---|---|
| PubChem CID | 135033930 |
| Molecular Formula | C11H14S2 |
| Molecular Weight | 210.37 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | (1S,9S)-3,6-dithiatricyclo[7.2.2.02,7]trideca-2(7),10-diene |
| SMILES | C1=C[C@@H]2CC[C@H]1CC1=C2SCCS1 |
| InChI | InChI=1S/C11H14S2/c1-3-9-4-2-8(1)7-10-11(9)13-6-5-12-10/h1,3,8-9H,2,4-7H2/t8-,9+/m0/s1 |
| InChIKey | BHUZKIFIPLOVEJ-DTWKUNHWSA-N |
| XLogP | 3.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.37 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|