C14H20S — CID 10013755
(2S,3R)-2,3-di(cyclohex-3-en-1-yl)thiirane (PubChem CID 10013755) has the molecular formula C14H20S and a molecular weight of 220.38 g/mol. Its IUPAC name is (2S,3R)-2,3-di(cyclohex-3-en-1-yl)thiirane.
| Compound Name | (2S,3R)-2,3-di(cyclohex-3-en-1-yl)thiirane |
|---|---|
| PubChem CID | 10013755 |
| Molecular Formula | C14H20S |
| Molecular Weight | 220.38 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | (2S,3R)-2,3-di(cyclohex-3-en-1-yl)thiirane |
| SMILES | C1=CCC([C@H]2S[C@H]2C2CC=CCC2)CC1 |
| InChI | InChI=1S/C14H20S/c1-3-7-11(8-4-1)13-14(15-13)12-9-5-2-6-10-12/h1-3,5,11-14H,4,6-10H2/t11?,12?,13-,14+ |
| InChIKey | XCUNLYLLDMLRLL-LLZFXZEUSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.38 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|