C15H26S — CID 134945755
(2R,3R,6R)-3-ethenyl-2-[(E)-pent-1-enyl]-6-propan-2-ylthiane (PubChem CID 134945755) has the molecular formula C15H26S and a molecular weight of 238.44 g/mol. Its IUPAC name is (2R,3R,6R)-3-ethenyl-2-[(E)-pent-1-enyl]-6-propan-2-ylthiane.
| Compound Name | (2R,3R,6R)-3-ethenyl-2-[(E)-pent-1-enyl]-6-propan-2-ylthiane |
|---|---|
| PubChem CID | 134945755 |
| Molecular Formula | C15H26S |
| Molecular Weight | 238.44 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | (2R,3R,6R)-3-ethenyl-2-[(E)-pent-1-enyl]-6-propan-2-ylthiane |
| SMILES | C=C[C@H]1CC[C@H](C(C)C)S[C@@H]1/C=C/CCC |
| InChI | InChI=1S/C15H26S/c1-5-7-8-9-15-13(6-2)10-11-14(16-15)12(3)4/h6,8-9,12-15H,2,5,7,10-11H2,1,3-4H3/b9-8+/t13-,14+,15+/m0/s1 |
| InChIKey | OLHVFQIZPMVBCO-SCAYIUIISA-N |
| XLogP | 5.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|