C13H20S2 — CID 134831164
2-[2-[(1R,2Z,6Z)-cycloocta-2,6-dien-1-yl]ethyl]-1,3-dithiolane (PubChem CID 134831164) has the molecular formula C13H20S2 and a molecular weight of 240.44 g/mol. Its IUPAC name is 2-[2-[(1R,2Z,6Z)-cycloocta-2,6-dien-1-yl]ethyl]-1,3-dithiolane.
| Compound Name | 2-[2-[(1R,2Z,6Z)-cycloocta-2,6-dien-1-yl]ethyl]-1,3-dithiolane |
|---|---|
| PubChem CID | 134831164 |
| Molecular Formula | C13H20S2 |
| Molecular Weight | 240.44 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-[2-[(1R,2Z,6Z)-cycloocta-2,6-dien-1-yl]ethyl]-1,3-dithiolane |
| SMILES | C1=C\C[C@@H](CCC2SCCS2)/C=C\CC/1 |
| InChI | InChI=1S/C13H20S2/c1-2-4-6-12(7-5-3-1)8-9-13-14-10-11-15-13/h2,4-5,7,12-13H,1,3,6,8-11H2/b4-2-,7-5-/t12-/m1/s1 |
| InChIKey | FBACVPKMSUIUIH-CCTUOEMJSA-N |
| XLogP | 4.49 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.44 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|