C14H18S — CID 15562724
(5aE,9Z)-1,4,4a,7,8,11,11a,11b-octahydrocycloocta[b][1]benzothiole (PubChem CID 15562724) has the molecular formula C14H18S and a molecular weight of 218.37 g/mol. Its IUPAC name is (5aE,9Z)-1,4,4a,7,8,11,11a,11b-octahydrocycloocta[b][1]benzothiole.
| Compound Name | (5aE,9Z)-1,4,4a,7,8,11,11a,11b-octahydrocycloocta[b][1]benzothiole |
|---|---|
| PubChem CID | 15562724 |
| Molecular Formula | C14H18S |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (5aE,9Z)-1,4,4a,7,8,11,11a,11b-octahydrocycloocta[b][1]benzothiole |
| SMILES | C1=CCC2C(C1)S/C1=C/CC/C=C\CC12 |
| InChI | InChI=1S/C14H18S/c1-2-4-9-13-11(7-3-1)12-8-5-6-10-14(12)15-13/h1,3,5-6,9,11-12,14H,2,4,7-8,10H2/b3-1-,13-9+ |
| InChIKey | RKSRTGBCJBBZLA-VHCMSTJDSA-N |
| XLogP | 4.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|