C11H18S — CID 134945768
(2R,3S)-3-ethenyl-2-[(E)-pent-1-enyl]thiolane (PubChem CID 134945768) has the molecular formula C11H18S and a molecular weight of 182.33 g/mol. Its IUPAC name is (2R,3S)-3-ethenyl-2-[(E)-pent-1-enyl]thiolane.
| Compound Name | (2R,3S)-3-ethenyl-2-[(E)-pent-1-enyl]thiolane |
|---|---|
| PubChem CID | 134945768 |
| Molecular Formula | C11H18S |
| Molecular Weight | 182.33 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | (2R,3S)-3-ethenyl-2-[(E)-pent-1-enyl]thiolane |
| SMILES | C=C[C@@H]1CCS[C@@H]1/C=C/CCC |
| InChI | InChI=1S/C11H18S/c1-3-5-6-7-11-10(4-2)8-9-12-11/h4,6-7,10-11H,2-3,5,8-9H2,1H3/b7-6+/t10-,11-/m1/s1 |
| InChIKey | JVAOAMYPCOAPAL-AFPRHGJPSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.33 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|