C8H14S — CID 15191429
5-butan-2-yl-2,3-dihydrothiophene (PubChem CID 15191429) has the molecular formula C8H14S and a molecular weight of 142.27 g/mol. Its IUPAC name is 5-butan-2-yl-2,3-dihydrothiophene.
| Compound Name | 5-butan-2-yl-2,3-dihydrothiophene |
|---|---|
| PubChem CID | 15191429 |
| Molecular Formula | C8H14S |
| Molecular Weight | 142.27 g/mol |
| Exact Mass | 142.08 |
| IUPAC Name | 5-butan-2-yl-2,3-dihydrothiophene |
| SMILES | CCC(C)C1=CCCS1 |
| InChI | InChI=1S/C8H14S/c1-3-7(2)8-5-4-6-9-8/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | SGEJGDRMAGYFRZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |