C8H13FS — CID 163607684
3-ethyl-5-fluoro-2,3,6,7-tetrahydrothiepine (PubChem CID 163607684) has the molecular formula C8H13FS and a molecular weight of 160.26 g/mol. Its IUPAC name is 3-ethyl-5-fluoro-2,3,6,7-tetrahydrothiepine.
| Compound Name | 3-ethyl-5-fluoro-2,3,6,7-tetrahydrothiepine |
|---|---|
| PubChem CID | 163607684 |
| Molecular Formula | C8H13FS |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 3-ethyl-5-fluoro-2,3,6,7-tetrahydrothiepine |
| SMILES | CCC1C=C(F)CCSC1 |
| InChI | InChI=1S/C8H13FS/c1-2-7-5-8(9)3-4-10-6-7/h5,7H,2-4,6H2,1H3 |
| InChIKey | HDEFNOQRAGBWGM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |