C13H22S — CID 134945717
(2R,3R)-2-[(E)-pent-1-enyl]-3-prop-1-en-2-ylthiane (PubChem CID 134945717) has the molecular formula C13H22S and a molecular weight of 210.39 g/mol. Its IUPAC name is (2R,3R)-2-[(E)-pent-1-enyl]-3-prop-1-en-2-ylthiane.
| Compound Name | (2R,3R)-2-[(E)-pent-1-enyl]-3-prop-1-en-2-ylthiane |
|---|---|
| PubChem CID | 134945717 |
| Molecular Formula | C13H22S |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (2R,3R)-2-[(E)-pent-1-enyl]-3-prop-1-en-2-ylthiane |
| SMILES | C=C(C)[C@H]1CCCS[C@@H]1/C=C/CCC |
| InChI | InChI=1S/C13H22S/c1-4-5-6-9-13-12(11(2)3)8-7-10-14-13/h6,9,12-13H,2,4-5,7-8,10H2,1,3H3/b9-6+/t12-,13-/m1/s1 |
| InChIKey | QISWRBYYACJWQT-BHAGLWOSSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|