C8H14N2 — CID 123230561
(Z)-N-propan-2-ylpent-2-ene-1,5-diimine (PubChem CID 123230561) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is (Z)-N-propan-2-ylpent-2-ene-1,5-diimine.
| Compound Name | (Z)-N-propan-2-ylpent-2-ene-1,5-diimine |
|---|---|
| PubChem CID | 123230561 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | (Z)-N-propan-2-ylpent-2-ene-1,5-diimine |
| SMILES | [H]/N=C/C/C=C\C=N\C(C)C |
| InChI | InChI=1S/C8H14N2/c1-8(2)10-7-5-3-4-6-9/h3,5-9H,4H2,1-2H3/b5-3-,9-6+,10-7+ |
| InChIKey | SOOUCSMFXIPHAC-TVAZVOFESA-N |
| XLogP | 2.06 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|