C8H12N2 — CID 90915516
3,3-dimethyl-2H-azepin-6-imine (PubChem CID 90915516) has the molecular formula C8H12N2 and a molecular weight of 136.20 g/mol. Its IUPAC name is 3,3-dimethyl-2H-azepin-6-imine.
| Compound Name | 3,3-dimethyl-2H-azepin-6-imine |
|---|---|
| PubChem CID | 90915516 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 3,3-dimethyl-2H-azepin-6-imine |
| SMILES | [H]/N=C1/C=CC(C)(C)CN=C1 |
| InChI | InChI=1S/C8H12N2/c1-8(2)4-3-7(9)5-10-6-8/h3-5,9H,6H2,1-2H3/b9-7- |
| InChIKey | XSTZIFOZLXNYGV-CLFYSBASSA-N |
| XLogP | 1.67 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|