C9H10N2 — CID 123712431
2-methanimidoyl-N-methylcyclohepta-2,4,6-trien-1-imine (PubChem CID 123712431) has the molecular formula C9H10N2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 2-methanimidoyl-N-methylcyclohepta-2,4,6-trien-1-imine.
| Compound Name | 2-methanimidoyl-N-methylcyclohepta-2,4,6-trien-1-imine |
|---|---|
| PubChem CID | 123712431 |
| Molecular Formula | C9H10N2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.08 |
| IUPAC Name | 2-methanimidoyl-N-methylcyclohepta-2,4,6-trien-1-imine |
| SMILES | [H]/N=C/c1ccccc/c1=N\C |
| InChI | InChI=1S/C9H10N2/c1-11-9-6-4-2-3-5-8(9)7-10/h2-7,10H,1H3/b10-7+,11-9+ |
| InChIKey | WTCDJHUBYYPFCB-PPZOTWNKSA-N |
| XLogP | 1.21 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|