C12H20N2 — CID 123259885
4-N,9-dimethyldeca-2,7-diene-1,4-diimine (PubChem CID 123259885) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 4-N,9-dimethyldeca-2,7-diene-1,4-diimine.
| Compound Name | 4-N,9-dimethyldeca-2,7-diene-1,4-diimine |
|---|---|
| PubChem CID | 123259885 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 4-N,9-dimethyldeca-2,7-diene-1,4-diimine |
| SMILES | [H]/N=C/C=C/C(CCC=CC(C)C)=N\C |
| InChI | InChI=1S/C12H20N2/c1-11(2)7-4-5-8-12(14-3)9-6-10-13/h4,6-7,9-11,13H,5,8H2,1-3H3/b7-4?,9-6?,13-10+,14-12- |
| InChIKey | PCTYHYYXGAXIIB-VHQYEFPUSA-N |
| XLogP | 3.26 |
| TPSA | 36.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|