C17H35N3 — CID 123230761
1-(cyclopropylideneamino)-1-N,1-N,1-N',1-N'-tetraethylhexane-1,1-diamine (PubChem CID 123230761) has the molecular formula C17H35N3 and a molecular weight of 281.49 g/mol. Its IUPAC name is 1-(cyclopropylideneamino)-1-N,1-N,1-N',1-N'-tetraethylhexane-1,1-diamine.
| Compound Name | 1-(cyclopropylideneamino)-1-N,1-N,1-N',1-N'-tetraethylhexane-1,1-diamine |
|---|---|
| PubChem CID | 123230761 |
| Molecular Formula | C17H35N3 |
| Molecular Weight | 281.49 g/mol |
| Exact Mass | 281.28 |
| IUPAC Name | 1-(cyclopropylideneamino)-1-N,1-N,1-N',1-N'-tetraethylhexane-1,1-diamine |
| SMILES | CCCCCC(N=C1CC1)(N(CC)CC)N(CC)CC |
| InChI | InChI=1S/C17H35N3/c1-6-11-12-15-17(18-16-13-14-16,19(7-2)8-3)20(9-4)10-5/h6-15H2,1-5H3 |
| InChIKey | HXISBBLJWZLIOU-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.49 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|