C12H20N6O — CID 123231124
3-imino-3-(3-methoxypyrrolidin-1-yl)-N'-(5-methyl-1H-pyrazol-3-yl)propanimidamide (PubChem CID 123231124) has the molecular formula C12H20N6O and a molecular weight of 264.33 g/mol. Its IUPAC name is 3-imino-3-(3-methoxypyrrolidin-1-yl)-N'-(5-methyl-1H-pyrazol-3-yl)propanimidamide.
| Compound Name | 3-imino-3-(3-methoxypyrrolidin-1-yl)-N'-(5-methyl-1H-pyrazol-3-yl)propanimidamide |
|---|---|
| PubChem CID | 123231124 |
| Molecular Formula | C12H20N6O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 3-imino-3-(3-methoxypyrrolidin-1-yl)-N'-(5-methyl-1H-pyrazol-3-yl)propanimidamide |
| SMILES | [H]/N=C(/C/C(N)=N/c1cc(C)[nH]n1)N1CCC(OC)C1 |
| InChI | InChI=1S/C12H20N6O/c1-8-5-12(17-16-8)15-10(13)6-11(14)18-4-3-9(7-18)19-2/h5,9,14H,3-4,6-7H2,1-2H3,(H3,13,15,16,17)/b14-11- |
| InChIKey | HJUIQJCCVUGHEH-KAMYIIQDSA-N |
| XLogP | 0.79 |
| TPSA | 103.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|