C19H28N6S — CID 123953720
3-imino-3-(5-methylazonan-1-yl)-N'-(5-thiophen-2-yl-1H-pyrazol-3-yl)propanimidamide (PubChem CID 123953720) has the molecular formula C19H28N6S and a molecular weight of 372.54 g/mol. Its IUPAC name is 3-imino-3-(5-methylazonan-1-yl)-N'-(5-thiophen-2-yl-1H-pyrazol-3-yl)propanimidamide.
| Compound Name | 3-imino-3-(5-methylazonan-1-yl)-N'-(5-thiophen-2-yl-1H-pyrazol-3-yl)propanimidamide |
|---|---|
| PubChem CID | 123953720 |
| Molecular Formula | C19H28N6S |
| Molecular Weight | 372.54 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | 3-imino-3-(5-methylazonan-1-yl)-N'-(5-thiophen-2-yl-1H-pyrazol-3-yl)propanimidamide |
| SMILES | [H]/N=C(\C/C(N)=N/c1cc(-c2cccs2)[nH]n1)N1CCCCC(C)CCC1 |
| InChI | InChI=1S/C19H28N6S/c1-14-6-2-3-9-25(10-4-7-14)18(21)13-17(20)22-19-12-15(23-24-19)16-8-5-11-26-16/h5,8,11-12,14,21H,2-4,6-7,9-10,13H2,1H3,(H3,20,22,23,24)/b21-18+ |
| InChIKey | IBLNMQNUHBDOFA-DYTRJAOYSA-N |
| XLogP | 4.40 |
| TPSA | 94.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.54 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|