C17H18N4OS2 — CID 91914597
5-methyl-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrrolidin-3-yl]thiophene-2-carboxamide (PubChem CID 91914597) has the molecular formula C17H18N4OS2 and a molecular weight of 358.49 g/mol. Its IUPAC name is 5-methyl-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrrolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | 5-methyl-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrrolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 91914597 |
| Molecular Formula | C17H18N4OS2 |
| Molecular Weight | 358.49 g/mol |
| Exact Mass | 358.09 |
| IUPAC Name | 5-methyl-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrrolidin-3-yl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)NC2CCN(c3cc(-c4cccs4)[nH]n3)C2)s1 |
| InChI | InChI=1S/C17H18N4OS2/c1-11-4-5-15(24-11)17(22)18-12-6-7-21(10-12)16-9-13(19-20-16)14-3-2-8-23-14/h2-5,8-9,12H,6-7,10H2,1H3,(H,18,22)(H,19,20) |
| InChIKey | SCZOEUVOWAQKSM-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |