C20H22N4OS2 — CID 91632025
2-methylsulfanyl-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperidin-4-yl]benzamide (PubChem CID 91632025) has the molecular formula C20H22N4OS2 and a molecular weight of 398.56 g/mol. Its IUPAC name is 2-methylsulfanyl-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperidin-4-yl]benzamide.
| Compound Name | 2-methylsulfanyl-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 91632025 |
| Molecular Formula | C20H22N4OS2 |
| Molecular Weight | 398.56 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-methylsulfanyl-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperidin-4-yl]benzamide |
| SMILES | CSc1ccccc1C(=O)NC1CCN(c2cc(-c3cccs3)[nH]n2)CC1 |
| InChI | InChI=1S/C20H22N4OS2/c1-26-17-6-3-2-5-15(17)20(25)21-14-8-10-24(11-9-14)19-13-16(22-23-19)18-7-4-12-27-18/h2-7,12-14H,8-11H2,1H3,(H,21,25)(H,22,23) |
| InChIKey | HAAPUPAGDSJQHH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |