C21H24N4O2S — CID 75528390
4-ethoxy-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperidin-4-yl]benzamide (PubChem CID 75528390) has the molecular formula C21H24N4O2S and a molecular weight of 396.52 g/mol. Its IUPAC name is 4-ethoxy-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperidin-4-yl]benzamide.
| Compound Name | 4-ethoxy-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 75528390 |
| Molecular Formula | C21H24N4O2S |
| Molecular Weight | 396.52 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 4-ethoxy-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)piperidin-4-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)NC2CCN(c3cc(-c4cccs4)[nH]n3)CC2)cc1 |
| InChI | InChI=1S/C21H24N4O2S/c1-2-27-17-7-5-15(6-8-17)21(26)22-16-9-11-25(12-10-16)20-14-18(23-24-20)19-4-3-13-28-19/h3-8,13-14,16H,2,9-12H2,1H3,(H,22,26)(H,23,24) |
| InChIKey | HPTLMHIFEJIHSO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |