C22H26N4O3S — CID 91904916
3,4-diethoxy-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrrolidin-3-yl]benzamide (PubChem CID 91904916) has the molecular formula C22H26N4O3S and a molecular weight of 426.54 g/mol. Its IUPAC name is 3,4-diethoxy-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrrolidin-3-yl]benzamide.
| Compound Name | 3,4-diethoxy-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrrolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 91904916 |
| Molecular Formula | C22H26N4O3S |
| Molecular Weight | 426.54 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | 3,4-diethoxy-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrrolidin-3-yl]benzamide |
| SMILES | CCOc1ccc(C(=O)NC2CCN(c3cc(-c4cccs4)[nH]n3)C2)cc1OCC |
| InChI | InChI=1S/C22H26N4O3S/c1-3-28-18-8-7-15(12-19(18)29-4-2)22(27)23-16-9-10-26(14-16)21-13-17(24-25-21)20-6-5-11-30-20/h5-8,11-13,16H,3-4,9-10,14H2,1-2H3,(H,23,27)(H,24,25) |
| InChIKey | VRQLTJZRBUUDRB-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 79.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.54 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |