C16H15BrN4O2S — CID 91888124
5-bromo-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrrolidin-3-yl]furan-2-carboxamide (PubChem CID 91888124) has the molecular formula C16H15BrN4O2S and a molecular weight of 407.29 g/mol. Its IUPAC name is 5-bromo-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrrolidin-3-yl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrrolidin-3-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 91888124 |
| Molecular Formula | C16H15BrN4O2S |
| Molecular Weight | 407.29 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 5-bromo-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrrolidin-3-yl]furan-2-carboxamide |
| SMILES | O=C(NC1CCN(c2cc(-c3cccs3)[nH]n2)C1)c1ccc(Br)o1 |
| InChI | InChI=1S/C16H15BrN4O2S/c17-14-4-3-12(23-14)16(22)18-10-5-6-21(9-10)15-8-11(19-20-15)13-2-1-7-24-13/h1-4,7-8,10H,5-6,9H2,(H,18,22)(H,19,20) |
| InChIKey | NJLFBSUODGYUSD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.29 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |