C18H19N5O2S — CID 91888166
6-methoxy-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrrolidin-3-yl]pyridine-3-carboxamide (PubChem CID 91888166) has the molecular formula C18H19N5O2S and a molecular weight of 369.45 g/mol. Its IUPAC name is 6-methoxy-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrrolidin-3-yl]pyridine-3-carboxamide.
| Compound Name | 6-methoxy-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrrolidin-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 91888166 |
| Molecular Formula | C18H19N5O2S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 6-methoxy-N-[1-(5-thiophen-2-yl-1H-pyrazol-3-yl)pyrrolidin-3-yl]pyridine-3-carboxamide |
| SMILES | COc1ccc(C(=O)NC2CCN(c3cc(-c4cccs4)[nH]n3)C2)cn1 |
| InChI | InChI=1S/C18H19N5O2S/c1-25-17-5-4-12(10-19-17)18(24)20-13-6-7-23(11-13)16-9-14(21-22-16)15-3-2-8-26-15/h2-5,8-10,13H,6-7,11H2,1H3,(H,20,24)(H,21,22) |
| InChIKey | GTECJIUUQLCTEJ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |